C21H19F4N3O3 — CID 17471154
1-(4-fluorobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperidine-4-carboxamide (PubChem CID 17471154) has the molecular formula C21H19F4N3O3 and a molecular weight of 437.39 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17471154 |
| Molecular Formula | C21H19F4N3O3 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(CNC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H19F4N3O3/c22-14-3-1-13(2-4-14)21(31)28-9-7-12(8-10-28)20(30)26-11-17(29)27-16-6-5-15(23)18(24)19(16)25/h1-6,12H,7-11H2,(H,26,30)(H,27,29) |
| InChIKey | BCOLBCVEYVYSCQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|