C24H31FN2O2 — CID 8923714
N-(1-adamantylmethyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 8923714) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 8923714 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-(1-adamantylmethyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H31FN2O2/c25-21-3-1-20(2-4-21)23(29)27-7-5-19(6-8-27)22(28)26-15-24-12-16-9-17(13-24)11-18(10-16)14-24/h1-4,16-19H,5-15H2,(H,26,28) |
| InChIKey | WLYJJDSYZLLSNN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |