C14H15F3N2O3 — CID 110754252
methyl 4-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 110754252) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is methyl 4-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110754252 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | methyl 4-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(C(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C14H15F3N2O3/c1-22-14(21)19-6-4-8(5-7-19)13(20)18-10-3-2-9(15)11(16)12(10)17/h2-3,8H,4-7H2,1H3,(H,18,20) |
| InChIKey | VEKNKZDFRSKJTJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|