C18H23F3N2O3 — CID 109146735
1-N-(3-methoxypropyl)-4-N-(2,3,4-trifluorophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109146735) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-N-(3-methoxypropyl)-4-N-(2,3,4-trifluorophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-(3-methoxypropyl)-4-N-(2,3,4-trifluorophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109146735 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-N-(3-methoxypropyl)-4-N-(2,3,4-trifluorophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | COCCCNC(=O)C1CCC(C(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H23F3N2O3/c1-26-10-2-9-22-17(24)11-3-5-12(6-4-11)18(25)23-14-8-7-13(19)15(20)16(14)21/h7-8,11-12H,2-6,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | PGYMKICSUHPHJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|