C17H24F3N3O3 — CID 78787969
N-(3-methoxypropyl)-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]acetamide (PubChem CID 78787969) has the molecular formula C17H24F3N3O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]acetamide |
|---|---|
| PubChem CID | 78787969 |
| Molecular Formula | C17H24F3N3O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-(3-methoxypropyl)-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]acetamide |
| SMILES | CCCN(CC(=O)NCCCOC)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H24F3N3O3/c1-3-8-23(10-14(24)21-7-4-9-26-2)11-15(25)22-13-6-5-12(18)16(19)17(13)20/h5-6H,3-4,7-11H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | GJXHNMKAZDMHPI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|