C21H23ClF3N3O2 — CID 27221850
2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 27221850) has the molecular formula C21H23ClF3N3O2 and a molecular weight of 441.88 g/mol. Its IUPAC name is 2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 27221850 |
| Molecular Formula | C21H23ClF3N3O2 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)CC(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C21H23ClF3N3O2/c1-4-7-28(10-17(29)26-16-6-5-15(23)19(24)20(16)25)11-18(30)27-21-13(3)8-12(2)9-14(21)22/h5-6,8-9H,4,7,10-11H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | WYZUCYWRQPVBSM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|