C21H24F3N3O2 — CID 27104051
2-[[2-(3-ethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 27104051) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[[2-(3-ethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(3-ethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 27104051 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[[2-(3-ethylanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1cccc(CC)c1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H24F3N3O2/c1-3-10-27(12-18(28)25-15-7-5-6-14(4-2)11-15)13-19(29)26-17-9-8-16(22)20(23)21(17)24/h5-9,11H,3-4,10,12-13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | YZCPHFVIXQBFAD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|