C21H23F3N4O3 — CID 78787968
2-[[2-(3-acetamidoanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 78787968) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-[[2-(3-acetamidoanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(3-acetamidoanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 78787968 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[[2-(3-acetamidoanilino)-2-oxoethyl]-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1cccc(NC(C)=O)c1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H23F3N4O3/c1-3-9-28(12-19(31)27-17-8-7-16(22)20(23)21(17)24)11-18(30)26-15-6-4-5-14(10-15)25-13(2)29/h4-8,10H,3,9,11-12H2,1-2H3,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | MMZHZDGKCIKCLW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|