C19H18F3N3O3 — CID 113131062
3-(3-acetamido-N-acetylanilino)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 113131062) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 3-(3-acetamido-N-acetylanilino)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(3-acetamido-N-acetylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 113131062 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-(3-acetamido-N-acetylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CC(=O)Nc1cccc(N(CCC(=O)Nc2ccc(F)c(F)c2F)C(C)=O)c1 |
| InChI | InChI=1S/C19H18F3N3O3/c1-11(26)23-13-4-3-5-14(10-13)25(12(2)27)9-8-17(28)24-16-7-6-15(20)18(21)19(16)22/h3-7,10H,8-9H2,1-2H3,(H,23,26)(H,24,28) |
| InChIKey | FGPQTRIZUICARG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|