C16H12F4N2O2 — CID 113177755
2-(N-acetyl-3-fluoroanilino)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 113177755) has the molecular formula C16H12F4N2O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 2-(N-acetyl-3-fluoroanilino)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(N-acetyl-3-fluoroanilino)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 113177755 |
| Molecular Formula | C16H12F4N2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(N-acetyl-3-fluoroanilino)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(F)c(F)c1F)c1cccc(F)c1 |
| InChI | InChI=1S/C16H12F4N2O2/c1-9(23)22(11-4-2-3-10(17)7-11)8-14(24)21-13-6-5-12(18)15(19)16(13)20/h2-7H,8H2,1H3,(H,21,24) |
| InChIKey | FPTBIRZLANVEEW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|