C17H12F3N3O2 — CID 113181013
2-(N-acetyl-3-cyanoanilino)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 113181013) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-(N-acetyl-3-cyanoanilino)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(N-acetyl-3-cyanoanilino)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 113181013 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-(N-acetyl-3-cyanoanilino)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(F)c(F)c1F)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H12F3N3O2/c1-10(24)23(12-4-2-3-11(7-12)8-21)9-15(25)22-14-6-5-13(18)16(19)17(14)20/h2-7H,9H2,1H3,(H,22,25) |
| InChIKey | ARMKKZXMDUDHHF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|