C18H16F2N2O3 — CID 113175525
2-(N,3-diacetylanilino)-N-(2,4-difluorophenyl)acetamide (PubChem CID 113175525) has the molecular formula C18H16F2N2O3 and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-(N,3-diacetylanilino)-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-(N,3-diacetylanilino)-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 113175525 |
| Molecular Formula | C18H16F2N2O3 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-(N,3-diacetylanilino)-N-(2,4-difluorophenyl)acetamide |
| SMILES | CC(=O)c1cccc(N(CC(=O)Nc2ccc(F)cc2F)C(C)=O)c1 |
| InChI | InChI=1S/C18H16F2N2O3/c1-11(23)13-4-3-5-15(8-13)22(12(2)24)10-18(25)21-17-7-6-14(19)9-16(17)20/h3-9H,10H2,1-2H3,(H,21,25) |
| InChIKey | CNHLZDNQJWNZKI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |