C18H18ClF3N2O3S — CID 32675529
2-[(2-chloro-4-methylphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 32675529) has the molecular formula C18H18ClF3N2O3S and a molecular weight of 434.87 g/mol. Its IUPAC name is 2-[(2-chloro-4-methylphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(2-chloro-4-methylphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 32675529 |
| Molecular Formula | C18H18ClF3N2O3S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-[(2-chloro-4-methylphenyl)sulfonyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)S(=O)(=O)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C18H18ClF3N2O3S/c1-3-8-24(28(26,27)15-7-4-11(2)9-12(15)19)10-16(25)23-14-6-5-13(20)17(21)18(14)22/h4-7,9H,3,8,10H2,1-2H3,(H,23,25) |
| InChIKey | XCULGMHNJIPHEN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|