C18H20F2N2O3S — CID 40746083
2-[(2,5-difluorophenyl)sulfonyl-propylamino]-N-(2-methylphenyl)acetamide (PubChem CID 40746083) has the molecular formula C18H20F2N2O3S and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)sulfonyl-propylamino]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(2,5-difluorophenyl)sulfonyl-propylamino]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 40746083 |
| Molecular Formula | C18H20F2N2O3S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[(2,5-difluorophenyl)sulfonyl-propylamino]-N-(2-methylphenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H20F2N2O3S/c1-3-10-22(12-18(23)21-16-7-5-4-6-13(16)2)26(24,25)17-11-14(19)8-9-15(17)20/h4-9,11H,3,10,12H2,1-2H3,(H,21,23) |
| InChIKey | ABXDBBPFVJVPRW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |