C20H30N2O5 — CID 109146700
4-N-(3,4-dimethoxyphenyl)-1-N-(3-methoxypropyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109146700) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-N-(3,4-dimethoxyphenyl)-1-N-(3-methoxypropyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3,4-dimethoxyphenyl)-1-N-(3-methoxypropyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109146700 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-N-(3,4-dimethoxyphenyl)-1-N-(3-methoxypropyl)cyclohexane-1,4-dicarboxamide |
| SMILES | COCCCNC(=O)C1CCC(C(=O)Nc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C20H30N2O5/c1-25-12-4-11-21-19(23)14-5-7-15(8-6-14)20(24)22-16-9-10-17(26-2)18(13-16)27-3/h9-10,13-15H,4-8,11-12H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | VJPUECLFRORDPV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|