C19H21ClFN4OS+ — CID 9214651
N-(2-chlorophenyl)-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9214651) has the molecular formula C19H21ClFN4OS+ and a molecular weight of 407.92 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9214651 |
| Molecular Formula | C19H21ClFN4OS+ |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-[(4-fluorophenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=S)Nc2ccc(F)cc2)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H20ClFN4OS/c20-16-3-1-2-4-17(16)23-18(26)13-24-9-11-25(12-10-24)19(27)22-15-7-5-14(21)6-8-15/h1-8H,9-13H2,(H,22,27)(H,23,26)/p+1 |
| InChIKey | KCRBWMDBGAUKSC-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|