C19H20ClFN3O2+ — CID 5061478
N-(4-chlorophenyl)-2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 5061478) has the molecular formula C19H20ClFN3O2+ and a molecular weight of 376.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 5061478 |
| Molecular Formula | C19H20ClFN3O2+ |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccccc2F)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClFN3O2/c20-14-5-7-15(8-6-14)22-18(25)13-23-9-11-24(12-10-23)19(26)16-3-1-2-4-17(16)21/h1-8H,9-13H2,(H,22,25)/p+1 |
| InChIKey | PYRNYABHRAAPTN-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |