C20H20F4N3O2+ — CID 9429578
2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 9429578) has the molecular formula C20H20F4N3O2+ and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9429578 |
| Molecular Formula | C20H20F4N3O2+ |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[4-(2-fluorobenzoyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccccc2F)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H19F4N3O2/c21-16-7-3-1-5-14(16)19(29)27-11-9-26(10-12-27)13-18(28)25-17-8-4-2-6-15(17)20(22,23)24/h1-8H,9-13H2,(H,25,28)/p+1 |
| InChIKey | KYDFIRWEBPTNCA-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |