C19H21F3N3O2S+ — CID 9429532
2-[4-(2-thiophen-3-ylacetyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 9429532) has the molecular formula C19H21F3N3O2S+ and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-[4-(2-thiophen-3-ylacetyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(2-thiophen-3-ylacetyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9429532 |
| Molecular Formula | C19H21F3N3O2S+ |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[4-(2-thiophen-3-ylacetyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)Cc2ccsc2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H20F3N3O2S/c20-19(21,22)15-3-1-2-4-16(15)23-17(26)12-24-6-8-25(9-7-24)18(27)11-14-5-10-28-13-14/h1-5,10,13H,6-9,11-12H2,(H,23,26)/p+1 |
| InChIKey | KYQGNILSTATASJ-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |