C19H25F3N3O2+ — CID 9429538
2-[4-(cyclopentanecarbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 9429538) has the molecular formula C19H25F3N3O2+ and a molecular weight of 384.42 g/mol. Its IUPAC name is 2-[4-(cyclopentanecarbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(cyclopentanecarbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9429538 |
| Molecular Formula | C19H25F3N3O2+ |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-[4-(cyclopentanecarbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)C2CCCC2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H24F3N3O2/c20-19(21,22)15-7-3-4-8-16(15)23-17(26)13-24-9-11-25(12-10-24)18(27)14-5-1-2-6-14/h3-4,7-8,14H,1-2,5-6,9-13H2,(H,23,26)/p+1 |
| InChIKey | KZKCIPZKVZKRLB-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |