C13H18F3N3O+2 — CID 2576082
2-piperazine-1,4-diium-1-yl-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 2576082) has the molecular formula C13H18F3N3O+2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-piperazine-1,4-diium-1-yl-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-piperazine-1,4-diium-1-yl-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2576082 |
| Molecular Formula | C13H18F3N3O+2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-piperazine-1,4-diium-1-yl-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[NH+]1CC[NH2+]CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)10-3-1-2-4-11(10)18-12(20)9-19-7-5-17-6-8-19/h1-4,17H,5-9H2,(H,18,20)/p+2 |
| InChIKey | LAPHONMHLQUVPN-UHFFFAOYSA-P |
| XLogP | -0.89 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |