C18H19F3N5O2+ — CID 9429520
2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 9429520) has the molecular formula C18H19F3N5O2+ and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9429520 |
| Molecular Formula | C18H19F3N5O2+ |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2cnccn2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3N5O2/c19-18(20,21)13-3-1-2-4-14(13)24-16(27)12-25-7-9-26(10-8-25)17(28)15-11-22-5-6-23-15/h1-6,11H,7-10,12H2,(H,24,27)/p+1 |
| InChIKey | LJORVCIYPIBTGM-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |