C14H23N3O+2 — CID 2409066
N-(2,4-dimethylphenyl)-2-piperazine-1,4-diium-1-ylacetamide (PubChem CID 2409066) has the molecular formula C14H23N3O+2 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-piperazine-1,4-diium-1-ylacetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-piperazine-1,4-diium-1-ylacetamide |
|---|---|
| PubChem CID | 2409066 |
| Molecular Formula | C14H23N3O+2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-piperazine-1,4-diium-1-ylacetamide |
| SMILES | Cc1ccc(NC(=O)C[NH+]2CC[NH2+]CC2)c(C)c1 |
| InChI | InChI=1S/C14H21N3O/c1-11-3-4-13(12(2)9-11)16-14(18)10-17-7-5-15-6-8-17/h3-4,9,15H,5-8,10H2,1-2H3,(H,16,18)/p+2 |
| InChIKey | DDQUQNRXRVUASN-UHFFFAOYSA-P |
| XLogP | -1.30 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |