C16H24N3O2+ — CID 8531065
1-[2-(2,5-dimethylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8531065) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-(2,5-dimethylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8531065 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-[2-(2,5-dimethylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C[NH+]2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-11-3-4-12(2)14(9-11)18-15(20)10-19-7-5-13(6-8-19)16(17)21/h3-4,9,13H,5-8,10H2,1-2H3,(H2,17,21)(H,18,20)/p+1 |
| InChIKey | DUMGCZGGAKDLBS-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |