C15H23N2O+ — CID 4742184
N-(2,5-dimethylphenyl)-3-pyrrolidin-1-ium-1-ylpropanamide (PubChem CID 4742184) has the molecular formula C15H23N2O+ and a molecular weight of 247.36 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-pyrrolidin-1-ium-1-ylpropanamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-pyrrolidin-1-ium-1-ylpropanamide |
|---|---|
| PubChem CID | 4742184 |
| Molecular Formula | C15H23N2O+ |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-pyrrolidin-1-ium-1-ylpropanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CC[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C15H22N2O/c1-12-5-6-13(2)14(11-12)16-15(18)7-10-17-8-3-4-9-17/h5-6,11H,3-4,7-10H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | MCCHJGFYUXQIMW-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |