C32H36N6O4 — CID 3604245
N'-[[4-[[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide (PubChem CID 3604245) has the molecular formula C32H36N6O4 and a molecular weight of 568.68 g/mol. Its IUPAC name is N'-[[4-[[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide.
| Compound Name | N'-[[4-[[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
|---|---|
| PubChem CID | 3604245 |
| Molecular Formula | C32H36N6O4 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | N'-[[4-[[[4-(2,5-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCC(=O)NN=Cc2ccc(C=NNC(=O)CCC(=O)Nc3cc(C)ccc3C)cc2)c1 |
| InChI | InChI=1S/C32H36N6O4/c1-21-5-7-23(3)27(17-21)35-29(39)13-15-31(41)37-33-19-25-9-11-26(12-10-25)20-34-38-32(42)16-14-30(40)36-28-18-22(2)6-8-24(28)4/h5-12,17-20H,13-16H2,1-4H3,(H,35,39)(H,36,40)(H,37,41)(H,38,42) |
| InChIKey | RSIZDUGROYPILP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|