C17H18N4O5 — CID 3289301
N-(2,5-dimethylphenyl)-N'-[(5-nitrofuran-2-yl)methylideneamino]butanediamide (PubChem CID 3289301) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N'-[(5-nitrofuran-2-yl)methylideneamino]butanediamide.
| Compound Name | N-(2,5-dimethylphenyl)-N'-[(5-nitrofuran-2-yl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3289301 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N'-[(5-nitrofuran-2-yl)methylideneamino]butanediamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCC(=O)NN=Cc2ccc([N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C17H18N4O5/c1-11-3-4-12(2)14(9-11)19-15(22)6-7-16(23)20-18-10-13-5-8-17(26-13)21(24)25/h3-5,8-10H,6-7H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | PUKXQAXVQOBSNA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|