C20H23N3O3 — CID 3286150
N-(2,5-dimethylphenyl)-N'-[(4-methoxyphenyl)methylideneamino]butanediamide (PubChem CID 3286150) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N'-[(4-methoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N-(2,5-dimethylphenyl)-N'-[(4-methoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3286150 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N'-[(4-methoxyphenyl)methylideneamino]butanediamide |
| SMILES | COc1ccc(C=NNC(=O)CCC(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-4-5-15(2)18(12-14)22-19(24)10-11-20(25)23-21-13-16-6-8-17(26-3)9-7-16/h4-9,12-13H,10-11H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | AEAVMCABUBCQGZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|