C21H24N4O4 — CID 6861549
N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]pentanediamide (PubChem CID 6861549) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]pentanediamide.
| Compound Name | N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 6861549 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]pentanediamide |
| SMILES | COc1ccc(/C=N/NC(=O)CCCC(=O)N/N=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O4/c1-28-18-10-6-16(7-11-18)14-22-24-20(26)4-3-5-21(27)25-23-15-17-8-12-19(29-2)13-9-17/h6-15H,3-5H2,1-2H3,(H,24,26)(H,25,27)/b22-14+,23-15+ |
| InChIKey | FCLFZMTZAVGGJN-HOFJZWJUSA-N |
| XLogP | 2.47 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|