C20H22N4O4 — CID 6869271
N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]butanediamide (PubChem CID 6869271) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 6869271 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N,N'-bis[(E)-(4-methoxyphenyl)methylideneamino]butanediamide |
| SMILES | COc1ccc(/C=N/NC(=O)CCC(=O)N/N=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-27-17-7-3-15(4-8-17)13-21-23-19(25)11-12-20(26)24-22-14-16-5-9-18(28-2)10-6-16/h3-10,13-14H,11-12H2,1-2H3,(H,23,25)(H,24,26)/b21-13+,22-14+ |
| InChIKey | QFWRSXSKGIWAFC-JFMUQQRKSA-N |
| XLogP | 2.08 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|