C15H22N3O2S+ — CID 8531098
1-[2-(2-methylsulfanylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8531098) has the molecular formula C15H22N3O2S+ and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[2-(2-methylsulfanylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-(2-methylsulfanylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8531098 |
| Molecular Formula | C15H22N3O2S+ |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[2-(2-methylsulfanylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
| SMILES | CSc1ccccc1NC(=O)C[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H21N3O2S/c1-21-13-5-3-2-4-12(13)17-14(19)10-18-8-6-11(7-9-18)15(16)20/h2-5,11H,6-10H2,1H3,(H2,16,20)(H,17,19)/p+1 |
| InChIKey | HGEHCPVXNKULBR-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |