C20H24N5O2+ — CID 8531125
1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8531125) has the molecular formula C20H24N5O2+ and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8531125 |
| Molecular Formula | C20H24N5O2+ |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](CC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C20H23N5O2/c21-20(27)15-10-12-25(13-11-15)14-19(26)22-16-6-8-18(9-7-16)24-23-17-4-2-1-3-5-17/h1-9,15H,10-14H2,(H2,21,27)(H,22,26)/p+1/b24-23+ |
| InChIKey | AUVDXTJJSJSOCX-WCWDXBQESA-O |
| XLogP | 1.82 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|