C22H27N4O3+ — CID 8931570
ethyl 1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8931570) has the molecular formula C22H27N4O3+ and a molecular weight of 395.48 g/mol. Its IUPAC name is ethyl 1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8931570 |
| Molecular Formula | C22H27N4O3+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | ethyl 1-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](CC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H26N4O3/c1-2-29-22(28)17-12-14-26(15-13-17)16-21(27)23-18-8-10-20(11-9-18)25-24-19-6-4-3-5-7-19/h3-11,17H,2,12-16H2,1H3,(H,23,27)/p+1/b25-24+ |
| InChIKey | LURRRHCNOWTRAC-OCOZRVBESA-O |
| XLogP | 2.90 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|