C20H31N2O3+ — CID 8931490
ethyl 1-[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8931490) has the molecular formula C20H31N2O3+ and a molecular weight of 347.48 g/mol. Its IUPAC name is ethyl 1-[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8931490 |
| Molecular Formula | C20H31N2O3+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | ethyl 1-[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](CC(=O)Nc2ccc([C@@H](C)CC)cc2)CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-4-15(3)16-6-8-18(9-7-16)21-19(23)14-22-12-10-17(11-13-22)20(24)25-5-2/h6-9,15,17H,4-5,10-14H2,1-3H3,(H,21,23)/p+1/t15-/m0/s1 |
| InChIKey | LAFGEXZYDXXSOC-HNNXBMFYSA-O |
| XLogP | 2.00 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |