C24H30N3O3+ — CID 2421643
ethyl 1-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 2421643) has the molecular formula C24H30N3O3+ and a molecular weight of 408.52 g/mol. Its IUPAC name is ethyl 1-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 2421643 |
| Molecular Formula | C24H30N3O3+ |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | ethyl 1-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](CC(=O)Nc2ccc3c(c2)c2ccccc2n3CC)CC1 |
| InChI | InChI=1S/C24H29N3O3/c1-3-27-21-8-6-5-7-19(21)20-15-18(9-10-22(20)27)25-23(28)16-26-13-11-17(12-14-26)24(29)30-4-2/h5-10,15,17H,3-4,11-14,16H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | NWWFCUOVUVALBZ-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |