C22H35N3O3+2 — CID 8773087
ethyl 1-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8773087) has the molecular formula C22H35N3O3+2 and a molecular weight of 389.54 g/mol. Its IUPAC name is ethyl 1-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8773087 |
| Molecular Formula | C22H35N3O3+2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | ethyl 1-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](CC(=O)NC2CC[NH+](Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C22H33N3O3/c1-2-28-22(27)19-8-12-25(13-9-19)17-21(26)23-20-10-14-24(15-11-20)16-18-6-4-3-5-7-18/h3-7,19-20H,2,8-17H2,1H3,(H,23,26)/p+2 |
| InChIKey | SREVAJXEAGIZQT-UHFFFAOYSA-P |
| XLogP | -0.79 |
| TPSA | 64.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |