C13H21N4S+ — CID 2429001
1-amino-3-(1-benzylpiperidin-1-ium-4-yl)thiourea (PubChem CID 2429001) has the molecular formula C13H21N4S+ and a molecular weight of 265.41 g/mol. Its IUPAC name is 1-amino-3-(1-benzylpiperidin-1-ium-4-yl)thiourea.
| Compound Name | 1-amino-3-(1-benzylpiperidin-1-ium-4-yl)thiourea |
|---|---|
| PubChem CID | 2429001 |
| Molecular Formula | C13H21N4S+ |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-amino-3-(1-benzylpiperidin-1-ium-4-yl)thiourea |
| SMILES | NNC(=S)NC1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H20N4S/c14-16-13(18)15-12-6-8-17(9-7-12)10-11-4-2-1-3-5-11/h1-5,12H,6-10,14H2,(H2,15,16,18)/p+1 |
| InChIKey | BMUIEDMPHSKQQK-UHFFFAOYSA-O |
| XLogP | -0.43 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|