C21H28N3OS+ — CID 2402593
1-(1-benzylpiperidin-1-ium-4-yl)-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 2402593) has the molecular formula C21H28N3OS+ and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-1-ium-4-yl)-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-(1-benzylpiperidin-1-ium-4-yl)-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 2402593 |
| Molecular Formula | C21H28N3OS+ |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-(1-benzylpiperidin-1-ium-4-yl)-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NC2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3OS/c1-25-20-9-7-17(8-10-20)15-22-21(26)23-19-11-13-24(14-12-19)16-18-5-3-2-4-6-18/h2-10,19H,11-16H2,1H3,(H2,22,23,26)/p+1 |
| InChIKey | OJDNWGADZKSJLW-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|