C15H24N3S+ — CID 8668980
1-(1-benzylpiperidin-1-ium-4-yl)-3-ethylthiourea (PubChem CID 8668980) has the molecular formula C15H24N3S+ and a molecular weight of 278.45 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-1-ium-4-yl)-3-ethylthiourea.
| Compound Name | 1-(1-benzylpiperidin-1-ium-4-yl)-3-ethylthiourea |
|---|---|
| PubChem CID | 8668980 |
| Molecular Formula | C15H24N3S+ |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(1-benzylpiperidin-1-ium-4-yl)-3-ethylthiourea |
| SMILES | CCNC(=S)NC1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H23N3S/c1-2-16-15(19)17-14-8-10-18(11-9-14)12-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3,(H2,16,17,19)/p+1 |
| InChIKey | WGNOUHKOLILQAV-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|