C20H24BrN2O+ — CID 9208935
N-(1-benzylpiperidin-1-ium-4-yl)-2-(4-bromophenyl)acetamide (PubChem CID 9208935) has the molecular formula C20H24BrN2O+ and a molecular weight of 388.33 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-2-(4-bromophenyl)acetamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 9208935 |
| Molecular Formula | C20H24BrN2O+ |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-(4-bromophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)NC1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23BrN2O/c21-18-8-6-16(7-9-18)14-20(24)22-19-10-12-23(13-11-19)15-17-4-2-1-3-5-17/h1-9,19H,10-15H2,(H,22,24)/p+1 |
| InChIKey | PKAIJGXARQUEAV-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |