C21H25FN3O2+ — CID 2534255
N-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 2534255) has the molecular formula C21H25FN3O2+ and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 2534255 |
| Molecular Formula | C21H25FN3O2+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[2-[(1-benzylpiperidin-1-ium-4-yl)amino]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)NC1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24FN3O2/c22-19-9-5-4-8-18(19)21(27)23-14-20(26)24-17-10-12-25(13-11-17)15-16-6-2-1-3-7-16/h1-9,17H,10-15H2,(H,23,27)(H,24,26)/p+1 |
| InChIKey | AJEULKUYXOLHDN-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |