C26H29N2O+ — CID 8909675
N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3,3-diphenylpropanamide (PubChem CID 8909675) has the molecular formula C26H29N2O+ and a molecular weight of 385.53 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3,3-diphenylpropanamide.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 8909675 |
| Molecular Formula | C26H29N2O+ |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N[C@H]1CC[NH+](Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H28N2O/c29-26(27-24-16-17-28(20-24)19-21-10-4-1-5-11-21)18-25(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,24-25H,16-20H2,(H,27,29)/p+1/t24-/m0/s1 |
| InChIKey | XFQNTEABJGRFEL-DEOSSOPVSA-O |
| XLogP | 3.18 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |