C23H29ClN3O2+ — CID 8590083
(3S)-3-acetamido-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-phenylpropanamide (PubChem CID 8590083) has the molecular formula C23H29ClN3O2+ and a molecular weight of 414.96 g/mol. Its IUPAC name is (3S)-3-acetamido-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-phenylpropanamide.
| Compound Name | (3S)-3-acetamido-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 8590083 |
| Molecular Formula | C23H29ClN3O2+ |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (3S)-3-acetamido-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-phenylpropanamide |
| SMILES | CC(=O)N[C@@H](CC(=O)NC1CC[NH+](Cc2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-17(28)25-22(19-5-3-2-4-6-19)15-23(29)26-21-11-13-27(14-12-21)16-18-7-9-20(24)10-8-18/h2-10,21-22H,11-16H2,1H3,(H,25,28)(H,26,29)/p+1/t22-/m0/s1 |
| InChIKey | HOMVTCIKJDJKDJ-QFIPXVFZSA-O |
| XLogP | 2.27 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |