C22H26ClN2O2+ — CID 8590176
N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-oxo-4-phenylbutanamide (PubChem CID 8590176) has the molecular formula C22H26ClN2O2+ and a molecular weight of 385.92 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 8590176 |
| Molecular Formula | C22H26ClN2O2+ |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-oxo-4-phenylbutanamide |
| SMILES | O=C(CCC(=O)c1ccccc1)NC1CC[NH+](Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN2O2/c23-19-8-6-17(7-9-19)16-25-14-12-20(13-15-25)24-22(27)11-10-21(26)18-4-2-1-3-5-18/h1-9,20H,10-16H2,(H,24,27)/p+1 |
| InChIKey | YQRILMFSVSVNGW-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |