C20H25N2OS+ — CID 7354720
N-(1-benzylpiperidin-1-ium-4-yl)-2-phenylsulfanylacetamide (PubChem CID 7354720) has the molecular formula C20H25N2OS+ and a molecular weight of 341.50 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 7354720 |
| Molecular Formula | C20H25N2OS+ |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)NC1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2OS/c23-20(16-24-19-9-5-2-6-10-19)21-18-11-13-22(14-12-18)15-17-7-3-1-4-8-17/h1-10,18H,11-16H2,(H,21,23)/p+1 |
| InChIKey | HMXBWGMMGHJHRQ-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |