C19H25N2OS+ — CID 9091102
N-(1-ethylpiperidin-1-ium-4-yl)-2-naphthalen-2-ylsulfanylacetamide (PubChem CID 9091102) has the molecular formula C19H25N2OS+ and a molecular weight of 329.49 g/mol. Its IUPAC name is N-(1-ethylpiperidin-1-ium-4-yl)-2-naphthalen-2-ylsulfanylacetamide.
| Compound Name | N-(1-ethylpiperidin-1-ium-4-yl)-2-naphthalen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 9091102 |
| Molecular Formula | C19H25N2OS+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(1-ethylpiperidin-1-ium-4-yl)-2-naphthalen-2-ylsulfanylacetamide |
| SMILES | CC[NH+]1CCC(NC(=O)CSc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C19H24N2OS/c1-2-21-11-9-17(10-12-21)20-19(22)14-23-18-8-7-15-5-3-4-6-16(15)13-18/h3-8,13,17H,2,9-12,14H2,1H3,(H,20,22)/p+1 |
| InChIKey | QTUCQVIHLHRDHQ-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |