C17H25N6OS+ — CID 8684683
N-(1-ethylpiperidin-1-ium-4-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 8684683) has the molecular formula C17H25N6OS+ and a molecular weight of 361.50 g/mol. Its IUPAC name is N-(1-ethylpiperidin-1-ium-4-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(1-ethylpiperidin-1-ium-4-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8684683 |
| Molecular Formula | C17H25N6OS+ |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-(1-ethylpiperidin-1-ium-4-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CC[NH+]1CCC(NC(=O)CSc2nnnn2-c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H24N6OS/c1-3-22-10-8-14(9-11-22)18-16(24)12-25-17-19-20-21-23(17)15-6-4-13(2)5-7-15/h4-7,14H,3,8-12H2,1-2H3,(H,18,24)/p+1 |
| InChIKey | JBPFYLKHNGBVCP-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |