C15H21N6OS+ — CID 8594426
N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 8594426) has the molecular formula C15H21N6OS+ and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8594426 |
| Molecular Formula | C15H21N6OS+ |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cn1nnnc1SCC(=O)N[C@H]1CC[NH+](Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H20N6OS/c1-20-15(17-18-19-20)23-11-14(22)16-13-7-8-21(10-13)9-12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,16,22)/p+1/t13-/m0/s1 |
| InChIKey | GNCTZDLGWBOZKW-ZDUSSCGKSA-O |
| XLogP | -0.72 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |