C14H19N7O2S — CID 90633186
2-(1-methyltetrazol-5-yl)sulfanyl-N-(4-pyrimidin-2-yloxycyclohexyl)acetamide (PubChem CID 90633186) has the molecular formula C14H19N7O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-(4-pyrimidin-2-yloxycyclohexyl)acetamide.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-(4-pyrimidin-2-yloxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 90633186 |
| Molecular Formula | C14H19N7O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-(4-pyrimidin-2-yloxycyclohexyl)acetamide |
| SMILES | Cn1nnnc1SCC(=O)NC1CCC(Oc2ncccn2)CC1 |
| InChI | InChI=1S/C14H19N7O2S/c1-21-14(18-19-20-21)24-9-12(22)17-10-3-5-11(6-4-10)23-13-15-7-2-8-16-13/h2,7-8,10-11H,3-6,9H2,1H3,(H,17,22) |
| InChIKey | VLXATXIARNLBDL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |