C8H9N7OS — CID 1301816
2-(1-methyltetrazol-5-yl)sulfanyl-N-pyrimidin-2-ylacetamide (PubChem CID 1301816) has the molecular formula C8H9N7OS and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 1301816 |
| Molecular Formula | C8H9N7OS |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-pyrimidin-2-ylacetamide |
| SMILES | Cn1nnnc1SCC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C8H9N7OS/c1-15-8(12-13-14-15)17-5-6(16)11-7-9-3-2-4-10-7/h2-4H,5H2,1H3,(H,9,10,11,16) |
| InChIKey | ZYCHZBCCAPNGFS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |